C12H16N2O2S2 — CID 82549051
N-ethyl-6-propan-2-ylsulfonyl-1,3-benzothiazol-2-amine (PubChem CID 82549051) has the molecular formula C12H16N2O2S2 and a molecular weight of 284.41 g/mol. Its IUPAC name is N-ethyl-6-propan-2-ylsulfonyl-1,3-benzothiazol-2-amine.
| Compound Name | N-ethyl-6-propan-2-ylsulfonyl-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 82549051 |
| Molecular Formula | C12H16N2O2S2 |
| Molecular Weight | 284.41 g/mol |
| Exact Mass | 284.07 |
| IUPAC Name | N-ethyl-6-propan-2-ylsulfonyl-1,3-benzothiazol-2-amine |
| SMILES | CCNc1nc2ccc(S(=O)(=O)C(C)C)cc2s1 |
| InChI | InChI=1S/C12H16N2O2S2/c1-4-13-12-14-10-6-5-9(7-11(10)17-12)18(15,16)8(2)3/h5-8H,4H2,1-3H3,(H,13,14) |
| InChIKey | CVNSKIFBYRNFCU-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.41 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |