C17H25N3O3S2 — CID 3310020
N-[6-[bis(2-methylpropyl)sulfamoyl]-1,3-benzothiazol-2-yl]acetamide (PubChem CID 3310020) has the molecular formula C17H25N3O3S2 and a molecular weight of 383.54 g/mol. Its IUPAC name is N-[6-[bis(2-methylpropyl)sulfamoyl]-1,3-benzothiazol-2-yl]acetamide.
| Compound Name | N-[6-[bis(2-methylpropyl)sulfamoyl]-1,3-benzothiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 3310020 |
| Molecular Formula | C17H25N3O3S2 |
| Molecular Weight | 383.54 g/mol |
| Exact Mass | 383.13 |
| IUPAC Name | N-[6-[bis(2-methylpropyl)sulfamoyl]-1,3-benzothiazol-2-yl]acetamide |
| SMILES | CC(=O)Nc1nc2ccc(S(=O)(=O)N(CC(C)C)CC(C)C)cc2s1 |
| InChI | InChI=1S/C17H25N3O3S2/c1-11(2)9-20(10-12(3)4)25(22,23)14-6-7-15-16(8-14)24-17(19-15)18-13(5)21/h6-8,11-12H,9-10H2,1-5H3,(H,18,19,21) |
| InChIKey | DXRAQMBHQYFXNT-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.54 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |