C31H35N5O7S2 — CID 509654
N-[(2S,3R)-4-[(2-acetamido-1,3-benzothiazol-6-yl)sulfonyl-(2-methylpropyl)amino]-3-hydroxy-1-phenylbutan-2-yl]-2-methyl-5-nitrobenzamide (PubChem CID 509654) has the molecular formula C31H35N5O7S2 and a molecular weight of 653.78 g/mol. Its IUPAC name is N-[(2S,3R)-4-[(2-acetamido-1,3-benzothiazol-6-yl)sulfonyl-(2-methylpropyl)amino]-3-hydroxy-1-phenylbutan-2-yl]-2-methyl-5-nitrobenzamide.
| Compound Name | N-[(2S,3R)-4-[(2-acetamido-1,3-benzothiazol-6-yl)sulfonyl-(2-methylpropyl)amino]-3-hydroxy-1-phenylbutan-2-yl]-2-methyl-5-nitrobenzamide |
|---|---|
| PubChem CID | 509654 |
| Molecular Formula | C31H35N5O7S2 |
| Molecular Weight | 653.78 g/mol |
| Exact Mass | 653.20 |
| IUPAC Name | N-[(2S,3R)-4-[(2-acetamido-1,3-benzothiazol-6-yl)sulfonyl-(2-methylpropyl)amino]-3-hydroxy-1-phenylbutan-2-yl]-2-methyl-5-nitrobenzamide |
| SMILES | CC(=O)Nc1nc2ccc(S(=O)(=O)N(CC(C)C)C[C@@H](O)[C@H](Cc3ccccc3)NC(=O)c3cc([N+](=O)[O-])ccc3C)cc2s1 |
| InChI | InChI=1S/C31H35N5O7S2/c1-19(2)17-35(45(42,43)24-12-13-26-29(16-24)44-31(34-26)32-21(4)37)18-28(38)27(14-22-8-6-5-7-9-22)33-30(39)25-15-23(36(40)41)11-10-20(25)3/h5-13,15-16,19,27-28,38H,14,17-18H2,1-4H3,(H,33,39)(H,32,34,37)/t27-,28+/m0/s1 |
| InChIKey | QVLMRFDIPQFDRH-WUFINQPMSA-N |
| XLogP | 4.52 |
| TPSA | 171.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.78 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|