C17H24ClN3O3S2 — CID 3368893
N-[6-[bis(2-methylpropyl)sulfamoyl]-1,3-benzothiazol-2-yl]-2-chloroacetamide (PubChem CID 3368893) has the molecular formula C17H24ClN3O3S2 and a molecular weight of 417.98 g/mol. Its IUPAC name is N-[6-[bis(2-methylpropyl)sulfamoyl]-1,3-benzothiazol-2-yl]-2-chloroacetamide.
| Compound Name | N-[6-[bis(2-methylpropyl)sulfamoyl]-1,3-benzothiazol-2-yl]-2-chloroacetamide |
|---|---|
| PubChem CID | 3368893 |
| Molecular Formula | C17H24ClN3O3S2 |
| Molecular Weight | 417.98 g/mol |
| Exact Mass | 417.09 |
| IUPAC Name | N-[6-[bis(2-methylpropyl)sulfamoyl]-1,3-benzothiazol-2-yl]-2-chloroacetamide |
| SMILES | CC(C)CN(CC(C)C)S(=O)(=O)c1ccc2nc(NC(=O)CCl)sc2c1 |
| InChI | InChI=1S/C17H24ClN3O3S2/c1-11(2)9-21(10-12(3)4)26(23,24)13-5-6-14-15(7-13)25-17(19-14)20-16(22)8-18/h5-7,11-12H,8-10H2,1-4H3,(H,19,20,22) |
| InChIKey | FOHPVKNJZBOQGF-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.98 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|