C10H12N2O2S2 — CID 82549906
6-propan-2-ylsulfonyl-1,3-benzothiazol-2-amine (PubChem CID 82549906) has the molecular formula C10H12N2O2S2 and a molecular weight of 256.35 g/mol. Its IUPAC name is 6-propan-2-ylsulfonyl-1,3-benzothiazol-2-amine.
| Compound Name | 6-propan-2-ylsulfonyl-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 82549906 |
| Molecular Formula | C10H12N2O2S2 |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.03 |
| IUPAC Name | 6-propan-2-ylsulfonyl-1,3-benzothiazol-2-amine |
| SMILES | CC(C)S(=O)(=O)c1ccc2nc(N)sc2c1 |
| InChI | InChI=1S/C10H12N2O2S2/c1-6(2)16(13,14)7-3-4-8-9(5-7)15-10(11)12-8/h3-6H,1-2H3,(H2,11,12) |
| InChIKey | SUGDVJYZQNCAKZ-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |