C14H12N2O2S2 — CID 20983952
6-(benzenesulfonylmethyl)-1,3-benzothiazol-2-amine (PubChem CID 20983952) has the molecular formula C14H12N2O2S2 and a molecular weight of 304.40 g/mol. Its IUPAC name is 6-(benzenesulfonylmethyl)-1,3-benzothiazol-2-amine.
| Compound Name | 6-(benzenesulfonylmethyl)-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 20983952 |
| Molecular Formula | C14H12N2O2S2 |
| Molecular Weight | 304.40 g/mol |
| Exact Mass | 304.03 |
| IUPAC Name | 6-(benzenesulfonylmethyl)-1,3-benzothiazol-2-amine |
| SMILES | Nc1nc2ccc(CS(=O)(=O)c3ccccc3)cc2s1 |
| InChI | InChI=1S/C14H12N2O2S2/c15-14-16-12-7-6-10(8-13(12)19-14)9-20(17,18)11-4-2-1-3-5-11/h1-8H,9H2,(H2,15,16) |
| InChIKey | PYYTVXOHCBGWEX-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.40 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |