C8H9ClN2O2S2 — CID 53433226
6-methylsulfonyl-1,3-benzothiazol-2-amine;hydrochloride (PubChem CID 53433226) has the molecular formula C8H9ClN2O2S2 and a molecular weight of 264.76 g/mol. Its IUPAC name is 6-methylsulfonyl-1,3-benzothiazol-2-amine;hydrochloride.
| Compound Name | 6-methylsulfonyl-1,3-benzothiazol-2-amine;hydrochloride |
|---|---|
| PubChem CID | 53433226 |
| Molecular Formula | C8H9ClN2O2S2 |
| Molecular Weight | 264.76 g/mol |
| Exact Mass | 263.98 |
| IUPAC Name | 6-methylsulfonyl-1,3-benzothiazol-2-amine;hydrochloride |
| SMILES | CS(=O)(=O)c1ccc2nc(N)sc2c1.Cl |
| InChI | InChI=1S/C8H8N2O2S2.ClH/c1-14(11,12)5-2-3-6-7(4-5)13-8(9)10-6;/h2-4H,1H3,(H2,9,10);1H |
| InChIKey | NEFLOLQJTNYDEZ-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.76 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |