C11H14N2O2S2 — CID 39106904
3-(6-methylsulfonyl-1,3-benzothiazol-2-yl)propan-1-amine (PubChem CID 39106904) has the molecular formula C11H14N2O2S2 and a molecular weight of 270.38 g/mol. Its IUPAC name is 3-(6-methylsulfonyl-1,3-benzothiazol-2-yl)propan-1-amine.
| Compound Name | 3-(6-methylsulfonyl-1,3-benzothiazol-2-yl)propan-1-amine |
|---|---|
| PubChem CID | 39106904 |
| Molecular Formula | C11H14N2O2S2 |
| Molecular Weight | 270.38 g/mol |
| Exact Mass | 270.05 |
| IUPAC Name | 3-(6-methylsulfonyl-1,3-benzothiazol-2-yl)propan-1-amine |
| SMILES | CS(=O)(=O)c1ccc2nc(CCCN)sc2c1 |
| InChI | InChI=1S/C11H14N2O2S2/c1-17(14,15)8-4-5-9-10(7-8)16-11(13-9)3-2-6-12/h4-5,7H,2-3,6,12H2,1H3 |
| InChIKey | PHEZRNHLNVDFCN-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.38 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |