C10H11FN2S — CID 43305639
3-(5-fluoro-1,3-benzothiazol-2-yl)propan-1-amine (PubChem CID 43305639) has the molecular formula C10H11FN2S and a molecular weight of 210.28 g/mol. Its IUPAC name is 3-(5-fluoro-1,3-benzothiazol-2-yl)propan-1-amine.
| Compound Name | 3-(5-fluoro-1,3-benzothiazol-2-yl)propan-1-amine |
|---|---|
| PubChem CID | 43305639 |
| Molecular Formula | C10H11FN2S |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.06 |
| IUPAC Name | 3-(5-fluoro-1,3-benzothiazol-2-yl)propan-1-amine |
| SMILES | NCCCc1nc2cc(F)ccc2s1 |
| InChI | InChI=1S/C10H11FN2S/c11-7-3-4-9-8(6-7)13-10(14-9)2-1-5-12/h3-4,6H,1-2,5,12H2 |
| InChIKey | UCEATBNFGQPPAF-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |