C14H10FNOS — CID 43306339
4-[(5-fluoro-1,3-benzothiazol-2-yl)methyl]phenol (PubChem CID 43306339) has the molecular formula C14H10FNOS and a molecular weight of 259.31 g/mol. Its IUPAC name is 4-[(5-fluoro-1,3-benzothiazol-2-yl)methyl]phenol.
| Compound Name | 4-[(5-fluoro-1,3-benzothiazol-2-yl)methyl]phenol |
|---|---|
| PubChem CID | 43306339 |
| Molecular Formula | C14H10FNOS |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.05 |
| IUPAC Name | 4-[(5-fluoro-1,3-benzothiazol-2-yl)methyl]phenol |
| SMILES | Oc1ccc(Cc2nc3cc(F)ccc3s2)cc1 |
| InChI | InChI=1S/C14H10FNOS/c15-10-3-6-13-12(8-10)16-14(18-13)7-9-1-4-11(17)5-2-9/h1-6,8,17H,7H2 |
| InChIKey | STAPMVBQCXVEBL-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |