C15H12FNS — CID 56978575
2-[2-(4-fluorophenyl)ethyl]-1,3-benzothiazole (PubChem CID 56978575) has the molecular formula C15H12FNS and a molecular weight of 257.33 g/mol. Its IUPAC name is 2-[2-(4-fluorophenyl)ethyl]-1,3-benzothiazole.
| Compound Name | 2-[2-(4-fluorophenyl)ethyl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 56978575 |
| Molecular Formula | C15H12FNS |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.07 |
| IUPAC Name | 2-[2-(4-fluorophenyl)ethyl]-1,3-benzothiazole |
| SMILES | Fc1ccc(CCc2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C15H12FNS/c16-12-8-5-11(6-9-12)7-10-15-17-13-3-1-2-4-14(13)18-15/h1-6,8-9H,7,10H2 |
| InChIKey | MCBDPDHRPUHPOU-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |