C12H15FN2S — CID 82688216
4-(5-fluoro-1,3-benzothiazol-2-yl)-2-methylbutan-1-amine (PubChem CID 82688216) has the molecular formula C12H15FN2S and a molecular weight of 238.33 g/mol. Its IUPAC name is 4-(5-fluoro-1,3-benzothiazol-2-yl)-2-methylbutan-1-amine.
| Compound Name | 4-(5-fluoro-1,3-benzothiazol-2-yl)-2-methylbutan-1-amine |
|---|---|
| PubChem CID | 82688216 |
| Molecular Formula | C12H15FN2S |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.09 |
| IUPAC Name | 4-(5-fluoro-1,3-benzothiazol-2-yl)-2-methylbutan-1-amine |
| SMILES | CC(CN)CCc1nc2cc(F)ccc2s1 |
| InChI | InChI=1S/C12H15FN2S/c1-8(7-14)2-5-12-15-10-6-9(13)3-4-11(10)16-12/h3-4,6,8H,2,5,7,14H2,1H3 |
| InChIKey | HAIITLYJXPWYFW-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |