C12H14BrNS — CID 79818549
2-(4-bromo-3-methylbutyl)-1,3-benzothiazole (PubChem CID 79818549) has the molecular formula C12H14BrNS and a molecular weight of 284.22 g/mol. Its IUPAC name is 2-(4-bromo-3-methylbutyl)-1,3-benzothiazole.
| Compound Name | 2-(4-bromo-3-methylbutyl)-1,3-benzothiazole |
|---|---|
| PubChem CID | 79818549 |
| Molecular Formula | C12H14BrNS |
| Molecular Weight | 284.22 g/mol |
| Exact Mass | 283.00 |
| IUPAC Name | 2-(4-bromo-3-methylbutyl)-1,3-benzothiazole |
| SMILES | CC(CBr)CCc1nc2ccccc2s1 |
| InChI | InChI=1S/C12H14BrNS/c1-9(8-13)6-7-12-14-10-4-2-3-5-11(10)15-12/h2-5,9H,6-8H2,1H3 |
| InChIKey | VBWGNJQNKWRXDF-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.22 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|