C10H12ClNO4S — CID 158890819
perchloric acid;2-propyl-1,3-benzothiazole (PubChem CID 158890819) has the molecular formula C10H12ClNO4S and a molecular weight of 277.73 g/mol. Its IUPAC name is perchloric acid;2-propyl-1,3-benzothiazole.
| Compound Name | perchloric acid;2-propyl-1,3-benzothiazole |
|---|---|
| PubChem CID | 158890819 |
| Molecular Formula | C10H12ClNO4S |
| Molecular Weight | 277.73 g/mol |
| Exact Mass | 277.02 |
| IUPAC Name | perchloric acid;2-propyl-1,3-benzothiazole |
| SMILES | CCCc1nc2ccccc2s1.[O-][Cl+3]([O-])([O-])O |
| InChI | InChI=1S/C10H11NS.ClHO4/c1-2-5-10-11-8-6-3-4-7-9(8)12-10;2-1(3,4)5/h3-4,6-7H,2,5H2,1H3;(H,2,3,4,5) |
| InChIKey | JEFBTUHIIJGAFN-UHFFFAOYSA-N |
| XLogP | -0.88 |
| TPSA | 102.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.73 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |