C13H17NOS — CID 104631696
1-(1,3-benzothiazol-2-yl)-4-methylpentan-3-ol (PubChem CID 104631696) has the molecular formula C13H17NOS and a molecular weight of 235.35 g/mol. Its IUPAC name is 1-(1,3-benzothiazol-2-yl)-4-methylpentan-3-ol.
| Compound Name | 1-(1,3-benzothiazol-2-yl)-4-methylpentan-3-ol |
|---|---|
| PubChem CID | 104631696 |
| Molecular Formula | C13H17NOS |
| Molecular Weight | 235.35 g/mol |
| Exact Mass | 235.10 |
| IUPAC Name | 1-(1,3-benzothiazol-2-yl)-4-methylpentan-3-ol |
| SMILES | CC(C)C(O)CCc1nc2ccccc2s1 |
| InChI | InChI=1S/C13H17NOS/c1-9(2)11(15)7-8-13-14-10-5-3-4-6-12(10)16-13/h3-6,9,11,15H,7-8H2,1-2H3 |
| InChIKey | QDCQCEOSWMYNSZ-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.35 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |