C13H17BrN2S — CID 104632043
N-(1,3-benzothiazol-2-ylmethyl)-N-(2-bromoethyl)propan-2-amine (PubChem CID 104632043) has the molecular formula C13H17BrN2S and a molecular weight of 313.26 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-ylmethyl)-N-(2-bromoethyl)propan-2-amine.
| Compound Name | N-(1,3-benzothiazol-2-ylmethyl)-N-(2-bromoethyl)propan-2-amine |
|---|---|
| PubChem CID | 104632043 |
| Molecular Formula | C13H17BrN2S |
| Molecular Weight | 313.26 g/mol |
| Exact Mass | 312.03 |
| IUPAC Name | N-(1,3-benzothiazol-2-ylmethyl)-N-(2-bromoethyl)propan-2-amine |
| SMILES | CC(C)N(CCBr)Cc1nc2ccccc2s1 |
| InChI | InChI=1S/C13H17BrN2S/c1-10(2)16(8-7-14)9-13-15-11-5-3-4-6-12(11)17-13/h3-6,10H,7-9H2,1-2H3 |
| InChIKey | PWXCGCZQKIELKX-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.26 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|