C14H18BrNS — CID 104632450
2-[2-(bromomethyl)-4-methylpentyl]-1,3-benzothiazole (PubChem CID 104632450) has the molecular formula C14H18BrNS and a molecular weight of 312.28 g/mol. Its IUPAC name is 2-[2-(bromomethyl)-4-methylpentyl]-1,3-benzothiazole.
| Compound Name | 2-[2-(bromomethyl)-4-methylpentyl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 104632450 |
| Molecular Formula | C14H18BrNS |
| Molecular Weight | 312.28 g/mol |
| Exact Mass | 311.03 |
| IUPAC Name | 2-[2-(bromomethyl)-4-methylpentyl]-1,3-benzothiazole |
| SMILES | CC(C)CC(CBr)Cc1nc2ccccc2s1 |
| InChI | InChI=1S/C14H18BrNS/c1-10(2)7-11(9-15)8-14-16-12-5-3-4-6-13(12)17-14/h3-6,10-11H,7-9H2,1-2H3 |
| InChIKey | GGOVMOFQOZTXOX-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.28 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|