C15H21FN2S — CID 79148771
3-[2-(6-fluoro-1,3-benzothiazol-2-yl)ethyl]hexan-1-amine (PubChem CID 79148771) has the molecular formula C15H21FN2S and a molecular weight of 280.41 g/mol. Its IUPAC name is 3-[2-(6-fluoro-1,3-benzothiazol-2-yl)ethyl]hexan-1-amine.
| Compound Name | 3-[2-(6-fluoro-1,3-benzothiazol-2-yl)ethyl]hexan-1-amine |
|---|---|
| PubChem CID | 79148771 |
| Molecular Formula | C15H21FN2S |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.14 |
| IUPAC Name | 3-[2-(6-fluoro-1,3-benzothiazol-2-yl)ethyl]hexan-1-amine |
| SMILES | CCCC(CCN)CCc1nc2ccc(F)cc2s1 |
| InChI | InChI=1S/C15H21FN2S/c1-2-3-11(8-9-17)4-7-15-18-13-6-5-12(16)10-14(13)19-15/h5-6,10-11H,2-4,7-9,17H2,1H3 |
| InChIKey | CPUATWLGXCETLG-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |