C9H12N2O3S2 — CID 174889953
azane;2-ethyl-1,3-benzothiazole-6-sulfonic acid (PubChem CID 174889953) has the molecular formula C9H12N2O3S2 and a molecular weight of 260.34 g/mol. Its IUPAC name is azane;2-ethyl-1,3-benzothiazole-6-sulfonic acid.
| Compound Name | azane;2-ethyl-1,3-benzothiazole-6-sulfonic acid |
|---|---|
| PubChem CID | 174889953 |
| Molecular Formula | C9H12N2O3S2 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.03 |
| IUPAC Name | azane;2-ethyl-1,3-benzothiazole-6-sulfonic acid |
| SMILES | CCc1nc2ccc(S(=O)(=O)O)cc2s1.N |
| InChI | InChI=1S/C9H9NO3S2.H3N/c1-2-9-10-7-4-3-6(15(11,12)13)5-8(7)14-9;/h3-5H,2H2,1H3,(H,11,12,13);1H3 |
| InChIKey | APTOGMCDGGCPDB-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 102.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|