C8H6FNO2S2 — CID 150804150
2-methyl-1,3-benzothiazole-6-sulfonyl fluoride (PubChem CID 150804150) has the molecular formula C8H6FNO2S2 and a molecular weight of 231.27 g/mol. Its IUPAC name is 2-methyl-1,3-benzothiazole-6-sulfonyl fluoride.
| Compound Name | 2-methyl-1,3-benzothiazole-6-sulfonyl fluoride |
|---|---|
| PubChem CID | 150804150 |
| Molecular Formula | C8H6FNO2S2 |
| Molecular Weight | 231.27 g/mol |
| Exact Mass | 230.98 |
| IUPAC Name | 2-methyl-1,3-benzothiazole-6-sulfonyl fluoride |
| SMILES | Cc1nc2ccc(S(=O)(=O)F)cc2s1 |
| InChI | InChI=1S/C8H6FNO2S2/c1-5-10-7-3-2-6(14(9,11)12)4-8(7)13-5/h2-4H,1H3 |
| InChIKey | KGMSYUNLZDVJNX-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.27 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |