C10H12N2O3S2 — CID 58839440
N-(methoxymethyl)-2-methyl-1,3-benzothiazole-6-sulfonamide (PubChem CID 58839440) has the molecular formula C10H12N2O3S2 and a molecular weight of 272.35 g/mol. Its IUPAC name is N-(methoxymethyl)-2-methyl-1,3-benzothiazole-6-sulfonamide.
| Compound Name | N-(methoxymethyl)-2-methyl-1,3-benzothiazole-6-sulfonamide |
|---|---|
| PubChem CID | 58839440 |
| Molecular Formula | C10H12N2O3S2 |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.03 |
| IUPAC Name | N-(methoxymethyl)-2-methyl-1,3-benzothiazole-6-sulfonamide |
| SMILES | COCNS(=O)(=O)c1ccc2nc(C)sc2c1 |
| InChI | InChI=1S/C10H12N2O3S2/c1-7-12-9-4-3-8(5-10(9)16-7)17(13,14)11-6-15-2/h3-5,11H,6H2,1-2H3 |
| InChIKey | GCCUWNOYTHXPAL-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|