C14H19N3O3S2 — CID 23603180
N-butyl-2-[(2-methyl-1,3-benzothiazol-6-yl)sulfonylamino]acetamide (PubChem CID 23603180) has the molecular formula C14H19N3O3S2 and a molecular weight of 341.46 g/mol. Its IUPAC name is N-butyl-2-[(2-methyl-1,3-benzothiazol-6-yl)sulfonylamino]acetamide.
| Compound Name | N-butyl-2-[(2-methyl-1,3-benzothiazol-6-yl)sulfonylamino]acetamide |
|---|---|
| PubChem CID | 23603180 |
| Molecular Formula | C14H19N3O3S2 |
| Molecular Weight | 341.46 g/mol |
| Exact Mass | 341.09 |
| IUPAC Name | N-butyl-2-[(2-methyl-1,3-benzothiazol-6-yl)sulfonylamino]acetamide |
| SMILES | CCCCNC(=O)CNS(=O)(=O)c1ccc2nc(C)sc2c1 |
| InChI | InChI=1S/C14H19N3O3S2/c1-3-4-7-15-14(18)9-16-22(19,20)11-5-6-12-13(8-11)21-10(2)17-12/h5-6,8,16H,3-4,7,9H2,1-2H3,(H,15,18) |
| InChIKey | XQUYRAJXAGXIPB-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.46 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|