C14H20IN3O4S — CID 46501725
N-butyl-2-[[2-[(4-iodophenyl)sulfonylamino]acetyl]amino]acetamide (PubChem CID 46501725) has the molecular formula C14H20IN3O4S and a molecular weight of 453.30 g/mol. Its IUPAC name is N-butyl-2-[[2-[(4-iodophenyl)sulfonylamino]acetyl]amino]acetamide.
| Compound Name | N-butyl-2-[[2-[(4-iodophenyl)sulfonylamino]acetyl]amino]acetamide |
|---|---|
| PubChem CID | 46501725 |
| Molecular Formula | C14H20IN3O4S |
| Molecular Weight | 453.30 g/mol |
| Exact Mass | 453.02 |
| IUPAC Name | N-butyl-2-[[2-[(4-iodophenyl)sulfonylamino]acetyl]amino]acetamide |
| SMILES | CCCCNC(=O)CNC(=O)CNS(=O)(=O)c1ccc(I)cc1 |
| InChI | InChI=1S/C14H20IN3O4S/c1-2-3-8-16-13(19)9-17-14(20)10-18-23(21,22)12-6-4-11(15)5-7-12/h4-7,18H,2-3,8-10H2,1H3,(H,16,19)(H,17,20) |
| InChIKey | ZMQVLIDREISXRI-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.30 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|