C14H19F4N3O5S2 — CID 57249769
N-butyl-2-[[2-(1,1,2,2-tetrafluoroethylsulfamoyl)phenyl]sulfonylamino]acetamide (PubChem CID 57249769) has the molecular formula C14H19F4N3O5S2 and a molecular weight of 449.45 g/mol. Its IUPAC name is N-butyl-2-[[2-(1,1,2,2-tetrafluoroethylsulfamoyl)phenyl]sulfonylamino]acetamide.
| Compound Name | N-butyl-2-[[2-(1,1,2,2-tetrafluoroethylsulfamoyl)phenyl]sulfonylamino]acetamide |
|---|---|
| PubChem CID | 57249769 |
| Molecular Formula | C14H19F4N3O5S2 |
| Molecular Weight | 449.45 g/mol |
| Exact Mass | 449.07 |
| IUPAC Name | N-butyl-2-[[2-(1,1,2,2-tetrafluoroethylsulfamoyl)phenyl]sulfonylamino]acetamide |
| SMILES | CCCCNC(=O)CNS(=O)(=O)c1ccccc1S(=O)(=O)NC(F)(F)C(F)F |
| InChI | InChI=1S/C14H19F4N3O5S2/c1-2-3-8-19-12(22)9-20-27(23,24)10-6-4-5-7-11(10)28(25,26)21-14(17,18)13(15)16/h4-7,13,20-21H,2-3,8-9H2,1H3,(H,19,22) |
| InChIKey | YBUWZAYMNIDHID-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 121.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.45 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|