C12H16BrN3O4S — CID 9224655
2-[[2-[(2-bromophenyl)sulfonylamino]acetyl]amino]-N-ethylacetamide (PubChem CID 9224655) has the molecular formula C12H16BrN3O4S and a molecular weight of 378.25 g/mol. Its IUPAC name is 2-[[2-[(2-bromophenyl)sulfonylamino]acetyl]amino]-N-ethylacetamide.
| Compound Name | 2-[[2-[(2-bromophenyl)sulfonylamino]acetyl]amino]-N-ethylacetamide |
|---|---|
| PubChem CID | 9224655 |
| Molecular Formula | C12H16BrN3O4S |
| Molecular Weight | 378.25 g/mol |
| Exact Mass | 377.00 |
| IUPAC Name | 2-[[2-[(2-bromophenyl)sulfonylamino]acetyl]amino]-N-ethylacetamide |
| SMILES | CCNC(=O)CNC(=O)CNS(=O)(=O)c1ccccc1Br |
| InChI | InChI=1S/C12H16BrN3O4S/c1-2-14-11(17)7-15-12(18)8-16-21(19,20)10-6-4-3-5-9(10)13/h3-6,16H,2,7-8H2,1H3,(H,14,17)(H,15,18) |
| InChIKey | XZKHRXNUQIYFDS-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.25 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |