C15H21IN2O5S — CID 3760299
methyl 2-[[2-[(4-iodophenyl)sulfonylamino]acetyl]amino]hexanoate (PubChem CID 3760299) has the molecular formula C15H21IN2O5S and a molecular weight of 468.31 g/mol. Its IUPAC name is methyl 2-[[2-[(4-iodophenyl)sulfonylamino]acetyl]amino]hexanoate.
| Compound Name | methyl 2-[[2-[(4-iodophenyl)sulfonylamino]acetyl]amino]hexanoate |
|---|---|
| PubChem CID | 3760299 |
| Molecular Formula | C15H21IN2O5S |
| Molecular Weight | 468.31 g/mol |
| Exact Mass | 468.02 |
| IUPAC Name | methyl 2-[[2-[(4-iodophenyl)sulfonylamino]acetyl]amino]hexanoate |
| SMILES | CCCCC(NC(=O)CNS(=O)(=O)c1ccc(I)cc1)C(=O)OC |
| InChI | InChI=1S/C15H21IN2O5S/c1-3-4-5-13(15(20)23-2)18-14(19)10-17-24(21,22)12-8-6-11(16)7-9-12/h6-9,13,17H,3-5,10H2,1-2H3,(H,18,19) |
| InChIKey | TZAFKJAUSFQCDS-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.31 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|