C16H22IN3O3S — CID 5101773
methyl 2-[[2-[(2-iodophenyl)carbamothioylamino]acetyl]amino]hexanoate (PubChem CID 5101773) has the molecular formula C16H22IN3O3S and a molecular weight of 463.34 g/mol. Its IUPAC name is methyl 2-[[2-[(2-iodophenyl)carbamothioylamino]acetyl]amino]hexanoate.
| Compound Name | methyl 2-[[2-[(2-iodophenyl)carbamothioylamino]acetyl]amino]hexanoate |
|---|---|
| PubChem CID | 5101773 |
| Molecular Formula | C16H22IN3O3S |
| Molecular Weight | 463.34 g/mol |
| Exact Mass | 463.04 |
| IUPAC Name | methyl 2-[[2-[(2-iodophenyl)carbamothioylamino]acetyl]amino]hexanoate |
| SMILES | CCCCC(NC(=O)CNC(=S)Nc1ccccc1I)C(=O)OC |
| InChI | InChI=1S/C16H22IN3O3S/c1-3-4-8-13(15(22)23-2)19-14(21)10-18-16(24)20-12-9-6-5-7-11(12)17/h5-7,9,13H,3-4,8,10H2,1-2H3,(H,19,21)(H2,18,20,24) |
| InChIKey | PGHGMMOBBIOHNH-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.34 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|