C17H24ClN3O3S — CID 3859397
methyl 2-[[2-[(2-chloro-4-methylphenyl)carbamothioylamino]acetyl]amino]hexanoate (PubChem CID 3859397) has the molecular formula C17H24ClN3O3S and a molecular weight of 385.92 g/mol. Its IUPAC name is methyl 2-[[2-[(2-chloro-4-methylphenyl)carbamothioylamino]acetyl]amino]hexanoate.
| Compound Name | methyl 2-[[2-[(2-chloro-4-methylphenyl)carbamothioylamino]acetyl]amino]hexanoate |
|---|---|
| PubChem CID | 3859397 |
| Molecular Formula | C17H24ClN3O3S |
| Molecular Weight | 385.92 g/mol |
| Exact Mass | 385.12 |
| IUPAC Name | methyl 2-[[2-[(2-chloro-4-methylphenyl)carbamothioylamino]acetyl]amino]hexanoate |
| SMILES | CCCCC(NC(=O)CNC(=S)Nc1ccc(C)cc1Cl)C(=O)OC |
| InChI | InChI=1S/C17H24ClN3O3S/c1-4-5-6-14(16(23)24-3)20-15(22)10-19-17(25)21-13-8-7-11(2)9-12(13)18/h7-9,14H,4-6,10H2,1-3H3,(H,20,22)(H2,19,21,25) |
| InChIKey | JTXFWHIZWWQALE-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.92 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|