C15H21ClN2O3 — CID 62011113
methyl 3-[[2-(2-chloro-4-methylanilino)-2-oxoethyl]-methylamino]-2-methylpropanoate (PubChem CID 62011113) has the molecular formula C15H21ClN2O3 and a molecular weight of 312.80 g/mol. Its IUPAC name is methyl 3-[[2-(2-chloro-4-methylanilino)-2-oxoethyl]-methylamino]-2-methylpropanoate.
| Compound Name | methyl 3-[[2-(2-chloro-4-methylanilino)-2-oxoethyl]-methylamino]-2-methylpropanoate |
|---|---|
| PubChem CID | 62011113 |
| Molecular Formula | C15H21ClN2O3 |
| Molecular Weight | 312.80 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | methyl 3-[[2-(2-chloro-4-methylanilino)-2-oxoethyl]-methylamino]-2-methylpropanoate |
| SMILES | COC(=O)C(C)CN(C)CC(=O)Nc1ccc(C)cc1Cl |
| InChI | InChI=1S/C15H21ClN2O3/c1-10-5-6-13(12(16)7-10)17-14(19)9-18(3)8-11(2)15(20)21-4/h5-7,11H,8-9H2,1-4H3,(H,17,19) |
| InChIKey | AKVMUJIQCINOIM-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.80 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |