C13H16BrClN2O3 — CID 62012088
methyl 3-[[2-(4-bromo-2-chloroanilino)-2-oxoethyl]-methylamino]propanoate (PubChem CID 62012088) has the molecular formula C13H16BrClN2O3 and a molecular weight of 363.64 g/mol. Its IUPAC name is methyl 3-[[2-(4-bromo-2-chloroanilino)-2-oxoethyl]-methylamino]propanoate.
| Compound Name | methyl 3-[[2-(4-bromo-2-chloroanilino)-2-oxoethyl]-methylamino]propanoate |
|---|---|
| PubChem CID | 62012088 |
| Molecular Formula | C13H16BrClN2O3 |
| Molecular Weight | 363.64 g/mol |
| Exact Mass | 362.00 |
| IUPAC Name | methyl 3-[[2-(4-bromo-2-chloroanilino)-2-oxoethyl]-methylamino]propanoate |
| SMILES | COC(=O)CCN(C)CC(=O)Nc1ccc(Br)cc1Cl |
| InChI | InChI=1S/C13H16BrClN2O3/c1-17(6-5-13(19)20-2)8-12(18)16-11-4-3-9(14)7-10(11)15/h3-4,7H,5-6,8H2,1-2H3,(H,16,18) |
| InChIKey | PCGSIMWNFHDWTI-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.64 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |