C16H14BrCl2FN2O — CID 24566377
N-(4-bromo-2-chlorophenyl)-2-[(2-chloro-6-fluorophenyl)methyl-methylamino]acetamide (PubChem CID 24566377) has the molecular formula C16H14BrCl2FN2O and a molecular weight of 420.11 g/mol. Its IUPAC name is N-(4-bromo-2-chlorophenyl)-2-[(2-chloro-6-fluorophenyl)methyl-methylamino]acetamide.
| Compound Name | N-(4-bromo-2-chlorophenyl)-2-[(2-chloro-6-fluorophenyl)methyl-methylamino]acetamide |
|---|---|
| PubChem CID | 24566377 |
| Molecular Formula | C16H14BrCl2FN2O |
| Molecular Weight | 420.11 g/mol |
| Exact Mass | 417.97 |
| IUPAC Name | N-(4-bromo-2-chlorophenyl)-2-[(2-chloro-6-fluorophenyl)methyl-methylamino]acetamide |
| SMILES | CN(CC(=O)Nc1ccc(Br)cc1Cl)Cc1c(F)cccc1Cl |
| InChI | InChI=1S/C16H14BrCl2FN2O/c1-22(8-11-12(18)3-2-4-14(11)20)9-16(23)21-15-6-5-10(17)7-13(15)19/h2-7H,8-9H2,1H3,(H,21,23) |
| InChIKey | ZBUIUPYPGFFBRB-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.11 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |