C15H14Cl2FN3O — CID 18087925
2-[(2-chloro-6-fluorophenyl)methyl-methylamino]-N-(5-chloro-2-pyridinyl)acetamide (PubChem CID 18087925) has the molecular formula C15H14Cl2FN3O and a molecular weight of 342.20 g/mol. Its IUPAC name is 2-[(2-chloro-6-fluorophenyl)methyl-methylamino]-N-(5-chloro-2-pyridinyl)acetamide.
| Compound Name | 2-[(2-chloro-6-fluorophenyl)methyl-methylamino]-N-(5-chloro-2-pyridinyl)acetamide |
|---|---|
| PubChem CID | 18087925 |
| Molecular Formula | C15H14Cl2FN3O |
| Molecular Weight | 342.20 g/mol |
| Exact Mass | 341.05 |
| IUPAC Name | 2-[(2-chloro-6-fluorophenyl)methyl-methylamino]-N-(5-chloro-2-pyridinyl)acetamide |
| SMILES | CN(CC(=O)Nc1ccc(Cl)cn1)Cc1c(F)cccc1Cl |
| InChI | InChI=1S/C15H14Cl2FN3O/c1-21(8-11-12(17)3-2-4-13(11)18)9-15(22)20-14-6-5-10(16)7-19-14/h2-7H,8-9H2,1H3,(H,19,20,22) |
| InChIKey | YPPLFPSWHOWKBT-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.20 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |