C14H19ClFN3O2 — CID 9197045
2-[(2-chloro-6-fluorophenyl)methyl-methylamino]-N-(propan-2-ylcarbamoyl)acetamide (PubChem CID 9197045) has the molecular formula C14H19ClFN3O2 and a molecular weight of 315.78 g/mol. Its IUPAC name is 2-[(2-chloro-6-fluorophenyl)methyl-methylamino]-N-(propan-2-ylcarbamoyl)acetamide.
| Compound Name | 2-[(2-chloro-6-fluorophenyl)methyl-methylamino]-N-(propan-2-ylcarbamoyl)acetamide |
|---|---|
| PubChem CID | 9197045 |
| Molecular Formula | C14H19ClFN3O2 |
| Molecular Weight | 315.78 g/mol |
| Exact Mass | 315.11 |
| IUPAC Name | 2-[(2-chloro-6-fluorophenyl)methyl-methylamino]-N-(propan-2-ylcarbamoyl)acetamide |
| SMILES | CC(C)NC(=O)NC(=O)CN(C)Cc1c(F)cccc1Cl |
| InChI | InChI=1S/C14H19ClFN3O2/c1-9(2)17-14(21)18-13(20)8-19(3)7-10-11(15)5-4-6-12(10)16/h4-6,9H,7-8H2,1-3H3,(H2,17,18,20,21) |
| InChIKey | DAZNNBGYXRDXIK-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.78 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |