C11H15ClFNO — CID 62333927
1-[(2-chloro-6-fluorophenyl)methyl-methylamino]propan-2-ol (PubChem CID 62333927) has the molecular formula C11H15ClFNO and a molecular weight of 231.70 g/mol. Its IUPAC name is 1-[(2-chloro-6-fluorophenyl)methyl-methylamino]propan-2-ol.
| Compound Name | 1-[(2-chloro-6-fluorophenyl)methyl-methylamino]propan-2-ol |
|---|---|
| PubChem CID | 62333927 |
| Molecular Formula | C11H15ClFNO |
| Molecular Weight | 231.70 g/mol |
| Exact Mass | 231.08 |
| IUPAC Name | 1-[(2-chloro-6-fluorophenyl)methyl-methylamino]propan-2-ol |
| SMILES | CC(O)CN(C)Cc1c(F)cccc1Cl |
| InChI | InChI=1S/C11H15ClFNO/c1-8(15)6-14(2)7-9-10(12)4-3-5-11(9)13/h3-5,8,15H,6-7H2,1-2H3 |
| InChIKey | LHJXXARXJHTLFQ-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.70 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |