C19H22ClFN2O3 — CID 55680016
N-[4-[3-[(2-chloro-6-fluorophenyl)methyl-methylamino]-2-hydroxypropoxy]phenyl]acetamide (PubChem CID 55680016) has the molecular formula C19H22ClFN2O3 and a molecular weight of 380.85 g/mol. Its IUPAC name is N-[4-[3-[(2-chloro-6-fluorophenyl)methyl-methylamino]-2-hydroxypropoxy]phenyl]acetamide.
| Compound Name | N-[4-[3-[(2-chloro-6-fluorophenyl)methyl-methylamino]-2-hydroxypropoxy]phenyl]acetamide |
|---|---|
| PubChem CID | 55680016 |
| Molecular Formula | C19H22ClFN2O3 |
| Molecular Weight | 380.85 g/mol |
| Exact Mass | 380.13 |
| IUPAC Name | N-[4-[3-[(2-chloro-6-fluorophenyl)methyl-methylamino]-2-hydroxypropoxy]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(OCC(O)CN(C)Cc2c(F)cccc2Cl)cc1 |
| InChI | InChI=1S/C19H22ClFN2O3/c1-13(24)22-14-6-8-16(9-7-14)26-12-15(25)10-23(2)11-17-18(20)4-3-5-19(17)21/h3-9,15,25H,10-12H2,1-2H3,(H,22,24) |
| InChIKey | YPQSKCLQMAMKGE-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.85 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |