C17H17Cl2NO4 — CID 51725545
N-[4-[(2R)-3-(2,5-dichlorophenoxy)-2-hydroxypropoxy]phenyl]acetamide (PubChem CID 51725545) has the molecular formula C17H17Cl2NO4 and a molecular weight of 370.23 g/mol. Its IUPAC name is N-[4-[(2R)-3-(2,5-dichlorophenoxy)-2-hydroxypropoxy]phenyl]acetamide.
| Compound Name | N-[4-[(2R)-3-(2,5-dichlorophenoxy)-2-hydroxypropoxy]phenyl]acetamide |
|---|---|
| PubChem CID | 51725545 |
| Molecular Formula | C17H17Cl2NO4 |
| Molecular Weight | 370.23 g/mol |
| Exact Mass | 369.05 |
| IUPAC Name | N-[4-[(2R)-3-(2,5-dichlorophenoxy)-2-hydroxypropoxy]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(OC[C@@H](O)COc2cc(Cl)ccc2Cl)cc1 |
| InChI | InChI=1S/C17H17Cl2NO4/c1-11(21)20-13-3-5-15(6-4-13)23-9-14(22)10-24-17-8-12(18)2-7-16(17)19/h2-8,14,22H,9-10H2,1H3,(H,20,21)/t14-/m1/s1 |
| InChIKey | RLUXIQDZXFSLAX-CQSZACIVSA-N |
| XLogP | 3.77 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.23 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |