C21H21Cl2N3O5 — CID 55665529
N-[4-[3-[4-(2,4-dichlorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-2-hydroxypropoxy]phenyl]acetamide (PubChem CID 55665529) has the molecular formula C21H21Cl2N3O5 and a molecular weight of 466.32 g/mol. Its IUPAC name is N-[4-[3-[4-(2,4-dichlorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-2-hydroxypropoxy]phenyl]acetamide.
| Compound Name | N-[4-[3-[4-(2,4-dichlorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-2-hydroxypropoxy]phenyl]acetamide |
|---|---|
| PubChem CID | 55665529 |
| Molecular Formula | C21H21Cl2N3O5 |
| Molecular Weight | 466.32 g/mol |
| Exact Mass | 465.09 |
| IUPAC Name | N-[4-[3-[4-(2,4-dichlorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-2-hydroxypropoxy]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(OCC(O)CN2C(=O)NC(C)(c3ccc(Cl)cc3Cl)C2=O)cc1 |
| InChI | InChI=1S/C21H21Cl2N3O5/c1-12(27)24-14-4-6-16(7-5-14)31-11-15(28)10-26-19(29)21(2,25-20(26)30)17-8-3-13(22)9-18(17)23/h3-9,15,28H,10-11H2,1-2H3,(H,24,27)(H,25,30) |
| InChIKey | SXFBMXOKEMAZAO-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.32 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|