C19H16Cl2FN3O3 — CID 51954629
3-[(4R)-4-(2,4-dichlorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(4-fluorophenyl)propanamide (PubChem CID 51954629) has the molecular formula C19H16Cl2FN3O3 and a molecular weight of 424.26 g/mol. Its IUPAC name is 3-[(4R)-4-(2,4-dichlorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(4-fluorophenyl)propanamide.
| Compound Name | 3-[(4R)-4-(2,4-dichlorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(4-fluorophenyl)propanamide |
|---|---|
| PubChem CID | 51954629 |
| Molecular Formula | C19H16Cl2FN3O3 |
| Molecular Weight | 424.26 g/mol |
| Exact Mass | 423.06 |
| IUPAC Name | 3-[(4R)-4-(2,4-dichlorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(4-fluorophenyl)propanamide |
| SMILES | C[C@]1(c2ccc(Cl)cc2Cl)NC(=O)N(CCC(=O)Nc2ccc(F)cc2)C1=O |
| InChI | InChI=1S/C19H16Cl2FN3O3/c1-19(14-7-2-11(20)10-15(14)21)17(27)25(18(28)24-19)9-8-16(26)23-13-5-3-12(22)4-6-13/h2-7,10H,8-9H2,1H3,(H,23,26)(H,24,28)/t19-/m1/s1 |
| InChIKey | PAHLRIKOLALRPM-LJQANCHMSA-N |
| XLogP | 3.93 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.26 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|