C17H16FN3O3S — CID 52514635
N-(4-fluorophenyl)-3-[(4S)-4-methyl-2,5-dioxo-4-thiophen-2-ylimidazolidin-1-yl]propanamide (PubChem CID 52514635) has the molecular formula C17H16FN3O3S and a molecular weight of 361.40 g/mol. Its IUPAC name is N-(4-fluorophenyl)-3-[(4S)-4-methyl-2,5-dioxo-4-thiophen-2-ylimidazolidin-1-yl]propanamide.
| Compound Name | N-(4-fluorophenyl)-3-[(4S)-4-methyl-2,5-dioxo-4-thiophen-2-ylimidazolidin-1-yl]propanamide |
|---|---|
| PubChem CID | 52514635 |
| Molecular Formula | C17H16FN3O3S |
| Molecular Weight | 361.40 g/mol |
| Exact Mass | 361.09 |
| IUPAC Name | N-(4-fluorophenyl)-3-[(4S)-4-methyl-2,5-dioxo-4-thiophen-2-ylimidazolidin-1-yl]propanamide |
| SMILES | C[C@]1(c2cccs2)NC(=O)N(CCC(=O)Nc2ccc(F)cc2)C1=O |
| InChI | InChI=1S/C17H16FN3O3S/c1-17(13-3-2-10-25-13)15(23)21(16(24)20-17)9-8-14(22)19-12-6-4-11(18)5-7-12/h2-7,10H,8-9H2,1H3,(H,19,22)(H,20,24)/t17-/m1/s1 |
| InChIKey | DOYGKOBBVIWUDX-QGZVFWFLSA-N |
| XLogP | 2.68 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.40 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|