C19H20N4O4S — CID 71900241
N-(benzylcarbamoyl)-3-(4-methyl-2,5-dioxo-4-thiophen-2-ylimidazolidin-1-yl)propanamide (PubChem CID 71900241) has the molecular formula C19H20N4O4S and a molecular weight of 400.46 g/mol. Its IUPAC name is N-(benzylcarbamoyl)-3-(4-methyl-2,5-dioxo-4-thiophen-2-ylimidazolidin-1-yl)propanamide.
| Compound Name | N-(benzylcarbamoyl)-3-(4-methyl-2,5-dioxo-4-thiophen-2-ylimidazolidin-1-yl)propanamide |
|---|---|
| PubChem CID | 71900241 |
| Molecular Formula | C19H20N4O4S |
| Molecular Weight | 400.46 g/mol |
| Exact Mass | 400.12 |
| IUPAC Name | N-(benzylcarbamoyl)-3-(4-methyl-2,5-dioxo-4-thiophen-2-ylimidazolidin-1-yl)propanamide |
| SMILES | CC1(c2cccs2)NC(=O)N(CCC(=O)NC(=O)NCc2ccccc2)C1=O |
| InChI | InChI=1S/C19H20N4O4S/c1-19(14-8-5-11-28-14)16(25)23(18(27)22-19)10-9-15(24)21-17(26)20-12-13-6-3-2-4-7-13/h2-8,11H,9-10,12H2,1H3,(H,22,27)(H2,20,21,24,26) |
| InChIKey | LPYCJUNWHOFVSK-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.46 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|