C14H19N3O3S — CID 94510412
2-[(4S)-4-methyl-2,5-dioxo-4-thiophen-2-ylimidazolidin-1-yl]-N-(2-methylpropyl)acetamide (PubChem CID 94510412) has the molecular formula C14H19N3O3S and a molecular weight of 309.39 g/mol. Its IUPAC name is 2-[(4S)-4-methyl-2,5-dioxo-4-thiophen-2-ylimidazolidin-1-yl]-N-(2-methylpropyl)acetamide.
| Compound Name | 2-[(4S)-4-methyl-2,5-dioxo-4-thiophen-2-ylimidazolidin-1-yl]-N-(2-methylpropyl)acetamide |
|---|---|
| PubChem CID | 94510412 |
| Molecular Formula | C14H19N3O3S |
| Molecular Weight | 309.39 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | 2-[(4S)-4-methyl-2,5-dioxo-4-thiophen-2-ylimidazolidin-1-yl]-N-(2-methylpropyl)acetamide |
| SMILES | CC(C)CNC(=O)CN1C(=O)N[C@](C)(c2cccs2)C1=O |
| InChI | InChI=1S/C14H19N3O3S/c1-9(2)7-15-11(18)8-17-12(19)14(3,16-13(17)20)10-5-4-6-21-10/h4-6,9H,7-8H2,1-3H3,(H,15,18)(H,16,20)/t14-/m1/s1 |
| InChIKey | MJMUNSHZQXCOAQ-CQSZACIVSA-N |
| XLogP | 1.29 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.39 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|