C23H21N3O3S — CID 55480274
N-(2-benzylphenyl)-2-(4-methyl-2,5-dioxo-4-thiophen-2-ylimidazolidin-1-yl)acetamide (PubChem CID 55480274) has the molecular formula C23H21N3O3S and a molecular weight of 419.51 g/mol. Its IUPAC name is N-(2-benzylphenyl)-2-(4-methyl-2,5-dioxo-4-thiophen-2-ylimidazolidin-1-yl)acetamide.
| Compound Name | N-(2-benzylphenyl)-2-(4-methyl-2,5-dioxo-4-thiophen-2-ylimidazolidin-1-yl)acetamide |
|---|---|
| PubChem CID | 55480274 |
| Molecular Formula | C23H21N3O3S |
| Molecular Weight | 419.51 g/mol |
| Exact Mass | 419.13 |
| IUPAC Name | N-(2-benzylphenyl)-2-(4-methyl-2,5-dioxo-4-thiophen-2-ylimidazolidin-1-yl)acetamide |
| SMILES | CC1(c2cccs2)NC(=O)N(CC(=O)Nc2ccccc2Cc2ccccc2)C1=O |
| InChI | InChI=1S/C23H21N3O3S/c1-23(19-12-7-13-30-19)21(28)26(22(29)25-23)15-20(27)24-18-11-6-5-10-17(18)14-16-8-3-2-4-9-16/h2-13H,14-15H2,1H3,(H,24,27)(H,25,29) |
| InChIKey | WCHAXPBSKYYNFQ-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.51 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|