C14H18N2O3S — CID 92582836
(5S)-3-(3,3-dimethyl-2-oxobutyl)-5-methyl-5-thiophen-2-ylimidazolidine-2,4-dione (PubChem CID 92582836) has the molecular formula C14H18N2O3S and a molecular weight of 294.38 g/mol. Its IUPAC name is (5S)-3-(3,3-dimethyl-2-oxobutyl)-5-methyl-5-thiophen-2-ylimidazolidine-2,4-dione.
| Compound Name | (5S)-3-(3,3-dimethyl-2-oxobutyl)-5-methyl-5-thiophen-2-ylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 92582836 |
| Molecular Formula | C14H18N2O3S |
| Molecular Weight | 294.38 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | (5S)-3-(3,3-dimethyl-2-oxobutyl)-5-methyl-5-thiophen-2-ylimidazolidine-2,4-dione |
| SMILES | CC(C)(C)C(=O)CN1C(=O)N[C@](C)(c2cccs2)C1=O |
| InChI | InChI=1S/C14H18N2O3S/c1-13(2,3)9(17)8-16-11(18)14(4,15-12(16)19)10-6-5-7-20-10/h5-7H,8H2,1-4H3,(H,15,19)/t14-/m1/s1 |
| InChIKey | GEERZSDWIZYXOM-CQSZACIVSA-N |
| XLogP | 2.13 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.38 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|