C18H15N3O3S — CID 51288570
3-[2-(1H-indol-3-yl)-2-oxoethyl]-5-methyl-5-thiophen-2-ylimidazolidine-2,4-dione (PubChem CID 51288570) has the molecular formula C18H15N3O3S and a molecular weight of 353.40 g/mol. Its IUPAC name is 3-[2-(1H-indol-3-yl)-2-oxoethyl]-5-methyl-5-thiophen-2-ylimidazolidine-2,4-dione.
| Compound Name | 3-[2-(1H-indol-3-yl)-2-oxoethyl]-5-methyl-5-thiophen-2-ylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 51288570 |
| Molecular Formula | C18H15N3O3S |
| Molecular Weight | 353.40 g/mol |
| Exact Mass | 353.08 |
| IUPAC Name | 3-[2-(1H-indol-3-yl)-2-oxoethyl]-5-methyl-5-thiophen-2-ylimidazolidine-2,4-dione |
| SMILES | CC1(c2cccs2)NC(=O)N(CC(=O)c2c[nH]c3ccccc23)C1=O |
| InChI | InChI=1S/C18H15N3O3S/c1-18(15-7-4-8-25-15)16(23)21(17(24)20-18)10-14(22)12-9-19-13-6-3-2-5-11(12)13/h2-9,19H,10H2,1H3,(H,20,24) |
| InChIKey | STIPBBZSPFWVHA-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 82.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.40 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|