C25H26N4O3S — CID 75884137
5-methyl-3-[2-[4-(naphthalen-1-ylmethyl)piperazin-1-yl]-2-oxoethyl]-5-thiophen-2-ylimidazolidine-2,4-dione (PubChem CID 75884137) has the molecular formula C25H26N4O3S and a molecular weight of 462.58 g/mol. Its IUPAC name is 5-methyl-3-[2-[4-(naphthalen-1-ylmethyl)piperazin-1-yl]-2-oxoethyl]-5-thiophen-2-ylimidazolidine-2,4-dione.
| Compound Name | 5-methyl-3-[2-[4-(naphthalen-1-ylmethyl)piperazin-1-yl]-2-oxoethyl]-5-thiophen-2-ylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 75884137 |
| Molecular Formula | C25H26N4O3S |
| Molecular Weight | 462.58 g/mol |
| Exact Mass | 462.17 |
| IUPAC Name | 5-methyl-3-[2-[4-(naphthalen-1-ylmethyl)piperazin-1-yl]-2-oxoethyl]-5-thiophen-2-ylimidazolidine-2,4-dione |
| SMILES | CC1(c2cccs2)NC(=O)N(CC(=O)N2CCN(Cc3cccc4ccccc34)CC2)C1=O |
| InChI | InChI=1S/C25H26N4O3S/c1-25(21-10-5-15-33-21)23(31)29(24(32)26-25)17-22(30)28-13-11-27(12-14-28)16-19-8-4-7-18-6-2-3-9-20(18)19/h2-10,15H,11-14,16-17H2,1H3,(H,26,32) |
| InChIKey | GAIIIVKIXDHJGH-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.58 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|