C24H26N4O3 — CID 30961017
(5R)-5-(furan-2-yl)-5-methyl-3-[[4-(naphthalen-1-ylmethyl)piperazin-1-yl]methyl]imidazolidine-2,4-dione (PubChem CID 30961017) has the molecular formula C24H26N4O3 and a molecular weight of 418.50 g/mol. Its IUPAC name is (5R)-5-(furan-2-yl)-5-methyl-3-[[4-(naphthalen-1-ylmethyl)piperazin-1-yl]methyl]imidazolidine-2,4-dione.
| Compound Name | (5R)-5-(furan-2-yl)-5-methyl-3-[[4-(naphthalen-1-ylmethyl)piperazin-1-yl]methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 30961017 |
| Molecular Formula | C24H26N4O3 |
| Molecular Weight | 418.50 g/mol |
| Exact Mass | 418.20 |
| IUPAC Name | (5R)-5-(furan-2-yl)-5-methyl-3-[[4-(naphthalen-1-ylmethyl)piperazin-1-yl]methyl]imidazolidine-2,4-dione |
| SMILES | C[C@]1(c2ccco2)NC(=O)N(CN2CCN(Cc3cccc4ccccc34)CC2)C1=O |
| InChI | InChI=1S/C24H26N4O3/c1-24(21-10-5-15-31-21)22(29)28(23(30)25-24)17-27-13-11-26(12-14-27)16-19-8-4-7-18-6-2-3-9-20(18)19/h2-10,15H,11-14,16-17H2,1H3,(H,25,30)/t24-/m1/s1 |
| InChIKey | CQAIDGJRYNPICB-XMMPIXPASA-N |
| XLogP | 2.98 |
| TPSA | 69.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.50 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|