C27H28N4O4 — CID 22109253
5-(1,3-benzodioxol-5-yl)-5-methyl-3-[[4-(naphthalen-1-ylmethyl)piperazin-1-yl]methyl]imidazolidine-2,4-dione (PubChem CID 22109253) has the molecular formula C27H28N4O4 and a molecular weight of 472.55 g/mol. Its IUPAC name is 5-(1,3-benzodioxol-5-yl)-5-methyl-3-[[4-(naphthalen-1-ylmethyl)piperazin-1-yl]methyl]imidazolidine-2,4-dione.
| Compound Name | 5-(1,3-benzodioxol-5-yl)-5-methyl-3-[[4-(naphthalen-1-ylmethyl)piperazin-1-yl]methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 22109253 |
| Molecular Formula | C27H28N4O4 |
| Molecular Weight | 472.55 g/mol |
| Exact Mass | 472.21 |
| IUPAC Name | 5-(1,3-benzodioxol-5-yl)-5-methyl-3-[[4-(naphthalen-1-ylmethyl)piperazin-1-yl]methyl]imidazolidine-2,4-dione |
| SMILES | CC1(c2ccc3c(c2)OCO3)NC(=O)N(CN2CCN(Cc3cccc4ccccc34)CC2)C1=O |
| InChI | InChI=1S/C27H28N4O4/c1-27(21-9-10-23-24(15-21)35-18-34-23)25(32)31(26(33)28-27)17-30-13-11-29(12-14-30)16-20-7-4-6-19-5-2-3-8-22(19)20/h2-10,15H,11-14,16-18H2,1H3,(H,28,33) |
| InChIKey | XMATVOXWWUQEAJ-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 74.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.55 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|