C20H17N3O3 — CID 2580074
(5S)-3-[2-(1H-indol-3-yl)-2-oxoethyl]-5-methyl-5-phenylimidazolidine-2,4-dione (PubChem CID 2580074) has the molecular formula C20H17N3O3 and a molecular weight of 347.37 g/mol. Its IUPAC name is (5S)-3-[2-(1H-indol-3-yl)-2-oxoethyl]-5-methyl-5-phenylimidazolidine-2,4-dione.
| Compound Name | (5S)-3-[2-(1H-indol-3-yl)-2-oxoethyl]-5-methyl-5-phenylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 2580074 |
| Molecular Formula | C20H17N3O3 |
| Molecular Weight | 347.37 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | (5S)-3-[2-(1H-indol-3-yl)-2-oxoethyl]-5-methyl-5-phenylimidazolidine-2,4-dione |
| SMILES | C[C@@]1(c2ccccc2)NC(=O)N(CC(=O)c2c[nH]c3ccccc23)C1=O |
| InChI | InChI=1S/C20H17N3O3/c1-20(13-7-3-2-4-8-13)18(25)23(19(26)22-20)12-17(24)15-11-21-16-10-6-5-9-14(15)16/h2-11,21H,12H2,1H3,(H,22,26)/t20-/m0/s1 |
| InChIKey | WOZSNJCVQOZVDE-FQEVSTJZSA-N |
| XLogP | 2.82 |
| TPSA | 82.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.37 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|