C27H23N3O3 — CID 41061049
(5S)-5-(3,4-dimethylphenyl)-3-[2-(1H-indol-3-yl)-2-oxoethyl]-5-phenylimidazolidine-2,4-dione (PubChem CID 41061049) has the molecular formula C27H23N3O3 and a molecular weight of 437.50 g/mol. Its IUPAC name is (5S)-5-(3,4-dimethylphenyl)-3-[2-(1H-indol-3-yl)-2-oxoethyl]-5-phenylimidazolidine-2,4-dione.
| Compound Name | (5S)-5-(3,4-dimethylphenyl)-3-[2-(1H-indol-3-yl)-2-oxoethyl]-5-phenylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 41061049 |
| Molecular Formula | C27H23N3O3 |
| Molecular Weight | 437.50 g/mol |
| Exact Mass | 437.17 |
| IUPAC Name | (5S)-5-(3,4-dimethylphenyl)-3-[2-(1H-indol-3-yl)-2-oxoethyl]-5-phenylimidazolidine-2,4-dione |
| SMILES | Cc1ccc([C@]2(c3ccccc3)NC(=O)N(CC(=O)c3c[nH]c4ccccc34)C2=O)cc1C |
| InChI | InChI=1S/C27H23N3O3/c1-17-12-13-20(14-18(17)2)27(19-8-4-3-5-9-19)25(32)30(26(33)29-27)16-24(31)22-15-28-23-11-7-6-10-21(22)23/h3-15,28H,16H2,1-2H3,(H,29,33)/t27-/m0/s1 |
| InChIKey | DZFRFSQRQBLKCK-MHZLTWQESA-N |
| XLogP | 4.46 |
| TPSA | 82.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.50 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|