C28H25N3O3 — CID 154775292
5-(3,4-dimethylphenyl)-3-[2-(2-methyl-1H-indol-3-yl)-2-oxoethyl]-5-phenylimidazolidine-2,4-dione (PubChem CID 154775292) has the molecular formula C28H25N3O3 and a molecular weight of 451.53 g/mol. Its IUPAC name is 5-(3,4-dimethylphenyl)-3-[2-(2-methyl-1H-indol-3-yl)-2-oxoethyl]-5-phenylimidazolidine-2,4-dione.
| Compound Name | 5-(3,4-dimethylphenyl)-3-[2-(2-methyl-1H-indol-3-yl)-2-oxoethyl]-5-phenylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 154775292 |
| Molecular Formula | C28H25N3O3 |
| Molecular Weight | 451.53 g/mol |
| Exact Mass | 451.19 |
| IUPAC Name | 5-(3,4-dimethylphenyl)-3-[2-(2-methyl-1H-indol-3-yl)-2-oxoethyl]-5-phenylimidazolidine-2,4-dione |
| SMILES | Cc1ccc(C2(c3ccccc3)NC(=O)N(CC(=O)c3c(C)[nH]c4ccccc34)C2=O)cc1C |
| InChI | InChI=1S/C28H25N3O3/c1-17-13-14-21(15-18(17)2)28(20-9-5-4-6-10-20)26(33)31(27(34)30-28)16-24(32)25-19(3)29-23-12-8-7-11-22(23)25/h4-15,29H,16H2,1-3H3,(H,30,34) |
| InChIKey | POMBDSYZWUPTJV-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 82.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.53 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|